C19H17F6N — CID 134838373
N-butyl-1,1-bis[4-(trifluoromethyl)phenyl]methanimine (PubChem CID 134838373) has the molecular formula C19H17F6N and a molecular weight of 373.34 g/mol. Its IUPAC name is N-butyl-1,1-bis[4-(trifluoromethyl)phenyl]methanimine.
| Compound Name | N-butyl-1,1-bis[4-(trifluoromethyl)phenyl]methanimine |
|---|---|
| PubChem CID | 134838373 |
| Molecular Formula | C19H17F6N |
| Molecular Weight | 373.34 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | N-butyl-1,1-bis[4-(trifluoromethyl)phenyl]methanimine |
| SMILES | CCCCN=C(c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H17F6N/c1-2-3-12-26-17(13-4-8-15(9-5-13)18(20,21)22)14-6-10-16(11-7-14)19(23,24)25/h4-11H,2-3,12H2,1H3 |
| InChIKey | ITROJRMFBSWZEF-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.34 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|