C17H18NO2Pd- — CID 134838406
acetic acid;1,1-diphenylprop-1-en-2-ylazanide;palladium (PubChem CID 134838406) has the molecular formula C17H18NO2Pd- and a molecular weight of 374.76 g/mol. Its IUPAC name is acetic acid;1,1-diphenylprop-1-en-2-ylazanide;palladium.
| Compound Name | acetic acid;1,1-diphenylprop-1-en-2-ylazanide;palladium |
|---|---|
| PubChem CID | 134838406 |
| Molecular Formula | C17H18NO2Pd- |
| Molecular Weight | 374.76 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | acetic acid;1,1-diphenylprop-1-en-2-ylazanide;palladium |
| SMILES | CC(=O)O.CC([NH-])=C(c1ccccc1)c1ccccc1.[Pd] |
| InChI | InChI=1S/C15H14N.C2H4O2.Pd/c1-12(16)15(13-8-4-2-5-9-13)14-10-6-3-7-11-14;1-2(3)4;/h2-11,16H,1H3;1H3,(H,3,4);/q-1;; |
| InChIKey | WTPAGMJWJFHBMR-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 61.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.76 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |