C23H36O4Si — CID 134839129
(2S,3R,7R,9R,11S,14S)-11-[tert-butyl(dimethyl)silyl]oxy-14-ethenyl-1,9,10-trimethyl-4,8-dioxatetracyclo[8.3.1.02,9.03,7]tetradec-12-en-5-one (PubChem CID 134839129) has the molecular formula C23H36O4Si and a molecular weight of 404.62 g/mol. Its IUPAC name is (2S,3R,7R,9R,11S,14S)-11-[tert-butyl(dimethyl)silyl]oxy-14-ethenyl-1,9,10-trimethyl-4,8-dioxatetracyclo[8.3.1.02,9.03,7]tetradec-12-en-5-one.
| Compound Name | (2S,3R,7R,9R,11S,14S)-11-[tert-butyl(dimethyl)silyl]oxy-14-ethenyl-1,9,10-trimethyl-4,8-dioxatetracyclo[8.3.1.02,9.03,7]tetradec-12-en-5-one |
|---|---|
| PubChem CID | 134839129 |
| Molecular Formula | C23H36O4Si |
| Molecular Weight | 404.62 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | (2S,3R,7R,9R,11S,14S)-11-[tert-butyl(dimethyl)silyl]oxy-14-ethenyl-1,9,10-trimethyl-4,8-dioxatetracyclo[8.3.1.02,9.03,7]tetradec-12-en-5-one |
| SMILES | C=C[C@H]1C2(C)C=C[C@H](O[Si](C)(C)C(C)(C)C)C1(C)[C@]1(C)O[C@@H]3CC(=O)O[C@@H]3[C@H]21 |
| InChI | InChI=1S/C23H36O4Si/c1-10-15-21(5)12-11-16(27-28(8,9)20(2,3)4)22(15,6)23(7)19(21)18-14(26-23)13-17(24)25-18/h10-12,14-16,18-19H,1,13H2,2-9H3/t14-,15+,16+,18+,19-,21?,22?,23-/m1/s1 |
| InChIKey | WHBVLNKEAZSSGR-ATRIABMESA-N |
| XLogP | 4.86 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.62 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|