C21H34O5Si — CID 91867434
(1S,2R,6R,7S,8S)-2-but-3-enyl-7-[tert-butyl(dimethyl)silyl]oxy-1,8-dimethyl-3,10-dioxatricyclo[6.3.0.02,6]undecane-4,9-dione (PubChem CID 91867434) has the molecular formula C21H34O5Si and a molecular weight of 394.58 g/mol. Its IUPAC name is (1S,2R,6R,7S,8S)-2-but-3-enyl-7-[tert-butyl(dimethyl)silyl]oxy-1,8-dimethyl-3,10-dioxatricyclo[6.3.0.02,6]undecane-4,9-dione.
| Compound Name | (1S,2R,6R,7S,8S)-2-but-3-enyl-7-[tert-butyl(dimethyl)silyl]oxy-1,8-dimethyl-3,10-dioxatricyclo[6.3.0.02,6]undecane-4,9-dione |
|---|---|
| PubChem CID | 91867434 |
| Molecular Formula | C21H34O5Si |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | (1S,2R,6R,7S,8S)-2-but-3-enyl-7-[tert-butyl(dimethyl)silyl]oxy-1,8-dimethyl-3,10-dioxatricyclo[6.3.0.02,6]undecane-4,9-dione |
| SMILES | C=CCC[C@@]12OC(=O)C[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@]1(C)C(=O)OC[C@@]21C |
| InChI | InChI=1S/C21H34O5Si/c1-9-10-11-21-14(12-15(22)25-21)16(26-27(7,8)18(2,3)4)20(6)17(23)24-13-19(20,21)5/h9,14,16H,1,10-13H2,2-8H3/t14-,16+,19-,20+,21-/m1/s1 |
| InChIKey | DGBBDHKQYAOIBI-ZDJZOETHSA-N |
| XLogP | 4.23 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|