C23H40O3Si — CID 135068734
(3aR,4S,6aS)-6,6-dimethyl-4-[(1S,2R)-2-methyl-1-triethylsilyloxybut-3-enyl]-3-prop-2-enyl-3a,4,5,6a-tetrahydro-3H-cyclopenta[b]furan-2-one (PubChem CID 135068734) has the molecular formula C23H40O3Si and a molecular weight of 392.66 g/mol. Its IUPAC name is (3aR,4S,6aS)-6,6-dimethyl-4-[(1S,2R)-2-methyl-1-triethylsilyloxybut-3-enyl]-3-prop-2-enyl-3a,4,5,6a-tetrahydro-3H-cyclopenta[b]furan-2-one.
| Compound Name | (3aR,4S,6aS)-6,6-dimethyl-4-[(1S,2R)-2-methyl-1-triethylsilyloxybut-3-enyl]-3-prop-2-enyl-3a,4,5,6a-tetrahydro-3H-cyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 135068734 |
| Molecular Formula | C23H40O3Si |
| Molecular Weight | 392.66 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | (3aR,4S,6aS)-6,6-dimethyl-4-[(1S,2R)-2-methyl-1-triethylsilyloxybut-3-enyl]-3-prop-2-enyl-3a,4,5,6a-tetrahydro-3H-cyclopenta[b]furan-2-one |
| SMILES | C=CCC1C(=O)O[C@H]2[C@@H]1[C@@H]([C@@H](O[Si](CC)(CC)CC)[C@H](C)C=C)CC2(C)C |
| InChI | InChI=1S/C23H40O3Si/c1-9-14-17-19-18(15-23(7,8)21(19)25-22(17)24)20(16(6)10-2)26-27(11-3,12-4)13-5/h9-10,16-21H,1-2,11-15H2,3-8H3/t16-,17?,18+,19+,20+,21+/m1/s1 |
| InChIKey | DARKFTZZLVMGDE-YMUGNUEYSA-N |
| XLogP | 5.98 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.66 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|