C29H55FO4Si2 — CID 57321819
(3S,3aR,4R,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-[3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyloct-1-enyl]-3-fluoro-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 57321819) has the molecular formula C29H55FO4Si2 and a molecular weight of 542.93 g/mol. Its IUPAC name is (3S,3aR,4R,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-[3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyloct-1-enyl]-3-fluoro-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3S,3aR,4R,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-[3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyloct-1-enyl]-3-fluoro-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 57321819 |
| Molecular Formula | C29H55FO4Si2 |
| Molecular Weight | 542.93 g/mol |
| Exact Mass | 542.36 |
| IUPAC Name | (3S,3aR,4R,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-[3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyloct-1-enyl]-3-fluoro-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CCCCC(C)(C)C(C=C[C@@H]1[C@@H]2[C@H](C[C@H]1O[Si](C)(C)C(C)(C)C)OC(=O)[C@H]2F)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H55FO4Si2/c1-14-15-18-29(8,9)23(34-36(12,13)28(5,6)7)17-16-20-21(33-35(10,11)27(2,3)4)19-22-24(20)25(30)26(31)32-22/h16-17,20-25H,14-15,18-19H2,1-13H3/t20-,21+,22-,23?,24+,25-/m0/s1 |
| InChIKey | VNAGOHQUPLSZRJ-SOYGWJALSA-N |
| XLogP | 8.44 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.93 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|