C17H30O3SSi — CID 164674482
(3S,3aR,4S,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-ethenyl-5-methyl-3-methylsulfanyl-3a,4,6,6a-tetrahydro-3H-cyclopenta[b]furan-2-one (PubChem CID 164674482) has the molecular formula C17H30O3SSi and a molecular weight of 342.58 g/mol. Its IUPAC name is (3S,3aR,4S,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-ethenyl-5-methyl-3-methylsulfanyl-3a,4,6,6a-tetrahydro-3H-cyclopenta[b]furan-2-one.
| Compound Name | (3S,3aR,4S,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-ethenyl-5-methyl-3-methylsulfanyl-3a,4,6,6a-tetrahydro-3H-cyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 164674482 |
| Molecular Formula | C17H30O3SSi |
| Molecular Weight | 342.58 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | (3S,3aR,4S,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-ethenyl-5-methyl-3-methylsulfanyl-3a,4,6,6a-tetrahydro-3H-cyclopenta[b]furan-2-one |
| SMILES | C=C[C@H]1[C@@H]2[C@H](C[C@@]1(C)O[Si](C)(C)C(C)(C)C)OC(=O)[C@H]2SC |
| InChI | InChI=1S/C17H30O3SSi/c1-9-11-13-12(19-15(18)14(13)21-6)10-17(11,5)20-22(7,8)16(2,3)4/h9,11-14H,1,10H2,2-8H3/t11-,12-,13+,14-,17+/m0/s1 |
| InChIKey | KPSYOJGZKQPAQV-JEJJNBGPSA-N |
| XLogP | 4.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.58 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|