C19H34O3Si — CID 11056887
(3aR,4R,6aR)-6,6-dimethyl-4-[(1R)-1-triethylsilyloxybut-3-enyl]-3a,4,5,6a-tetrahydro-3H-cyclopenta[b]furan-2-one (PubChem CID 11056887) has the molecular formula C19H34O3Si and a molecular weight of 338.56 g/mol. Its IUPAC name is (3aR,4R,6aR)-6,6-dimethyl-4-[(1R)-1-triethylsilyloxybut-3-enyl]-3a,4,5,6a-tetrahydro-3H-cyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R,6aR)-6,6-dimethyl-4-[(1R)-1-triethylsilyloxybut-3-enyl]-3a,4,5,6a-tetrahydro-3H-cyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 11056887 |
| Molecular Formula | C19H34O3Si |
| Molecular Weight | 338.56 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | (3aR,4R,6aR)-6,6-dimethyl-4-[(1R)-1-triethylsilyloxybut-3-enyl]-3a,4,5,6a-tetrahydro-3H-cyclopenta[b]furan-2-one |
| SMILES | C=CC[C@@H](O[Si](CC)(CC)CC)[C@@H]1CC(C)(C)[C@@H]2OC(=O)C[C@H]12 |
| InChI | InChI=1S/C19H34O3Si/c1-7-11-16(22-23(8-2,9-3)10-4)15-13-19(5,6)18-14(15)12-17(20)21-18/h7,14-16,18H,1,8-13H2,2-6H3/t14-,15-,16-,18-/m1/s1 |
| InChIKey | ACUKARDZJUEGJF-YFHUEUNASA-N |
| XLogP | 4.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.56 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|