C23H38O3Si — CID 134840435
(4S,5R)-5-[(1R,2S,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-prop-1-en-2-ylcyclopentyl]-3-methylidene-4-prop-2-enyloxolan-2-one (PubChem CID 134840435) has the molecular formula C23H38O3Si and a molecular weight of 390.64 g/mol. Its IUPAC name is (4S,5R)-5-[(1R,2S,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-prop-1-en-2-ylcyclopentyl]-3-methylidene-4-prop-2-enyloxolan-2-one.
| Compound Name | (4S,5R)-5-[(1R,2S,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-prop-1-en-2-ylcyclopentyl]-3-methylidene-4-prop-2-enyloxolan-2-one |
|---|---|
| PubChem CID | 134840435 |
| Molecular Formula | C23H38O3Si |
| Molecular Weight | 390.64 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | (4S,5R)-5-[(1R,2S,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-prop-1-en-2-ylcyclopentyl]-3-methylidene-4-prop-2-enyloxolan-2-one |
| SMILES | C=CC[C@H]1C(=C)C(=O)O[C@@H]1[C@H]1[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C(=C)C |
| InChI | InChI=1S/C23H38O3Si/c1-11-12-17-15(4)22(24)25-21(17)20-16(5)19(13-18(20)14(2)3)26-27(9,10)23(6,7)8/h11,16-21H,1-2,4,12-13H2,3,5-10H3/t16-,17+,18+,19-,20+,21+/m1/s1 |
| InChIKey | FOLHRJSHRYJYDV-SSFAQJFESA-N |
| XLogP | 5.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.64 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|