C24H39NO3Si — CID 139114183
2-[(3S,4S,5S)-5-[(1R,2S,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-prop-1-en-2-ylcyclopentyl]-2-oxo-4-prop-2-enyloxolan-3-yl]acetonitrile (PubChem CID 139114183) has the molecular formula C24H39NO3Si and a molecular weight of 417.67 g/mol. Its IUPAC name is 2-[(3S,4S,5S)-5-[(1R,2S,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-prop-1-en-2-ylcyclopentyl]-2-oxo-4-prop-2-enyloxolan-3-yl]acetonitrile.
| Compound Name | 2-[(3S,4S,5S)-5-[(1R,2S,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-prop-1-en-2-ylcyclopentyl]-2-oxo-4-prop-2-enyloxolan-3-yl]acetonitrile |
|---|---|
| PubChem CID | 139114183 |
| Molecular Formula | C24H39NO3Si |
| Molecular Weight | 417.67 g/mol |
| Exact Mass | 417.27 |
| IUPAC Name | 2-[(3S,4S,5S)-5-[(1R,2S,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-prop-1-en-2-ylcyclopentyl]-2-oxo-4-prop-2-enyloxolan-3-yl]acetonitrile |
| SMILES | C=CC[C@@H]1[C@@H]([C@H]2[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]2C(=C)C)OC(=O)[C@H]1CC#N |
| InChI | InChI=1S/C24H39NO3Si/c1-10-11-17-18(12-13-25)23(26)27-22(17)21-16(4)20(14-19(21)15(2)3)28-29(8,9)24(5,6)7/h10,16-22H,1-2,11-12,14H2,3-9H3/t16-,17+,18+,19+,20-,21+,22+/m1/s1 |
| InChIKey | IIPLLSCZDWQHRW-JASYKLOUSA-N |
| XLogP | 5.87 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.67 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|