C22H38O3Si — CID 10904960
(3S,3aS,4R,6aR)-6,6-dimethyl-3-prop-2-enyl-4-[(1S)-1-triethylsilyloxybut-3-enyl]-3a,4,5,6a-tetrahydro-3H-cyclopenta[b]furan-2-one (PubChem CID 10904960) has the molecular formula C22H38O3Si and a molecular weight of 378.63 g/mol. Its IUPAC name is (3S,3aS,4R,6aR)-6,6-dimethyl-3-prop-2-enyl-4-[(1S)-1-triethylsilyloxybut-3-enyl]-3a,4,5,6a-tetrahydro-3H-cyclopenta[b]furan-2-one.
| Compound Name | (3S,3aS,4R,6aR)-6,6-dimethyl-3-prop-2-enyl-4-[(1S)-1-triethylsilyloxybut-3-enyl]-3a,4,5,6a-tetrahydro-3H-cyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 10904960 |
| Molecular Formula | C22H38O3Si |
| Molecular Weight | 378.63 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | (3S,3aS,4R,6aR)-6,6-dimethyl-3-prop-2-enyl-4-[(1S)-1-triethylsilyloxybut-3-enyl]-3a,4,5,6a-tetrahydro-3H-cyclopenta[b]furan-2-one |
| SMILES | C=CC[C@H](O[Si](CC)(CC)CC)[C@@H]1CC(C)(C)[C@@H]2OC(=O)[C@@H](CC=C)[C@H]12 |
| InChI | InChI=1S/C22H38O3Si/c1-8-13-16-19-17(15-22(6,7)20(19)24-21(16)23)18(14-9-2)25-26(10-3,11-4)12-5/h8-9,16-20H,1-2,10-15H2,3-7H3/t16-,17-,18-,19+,20+/m0/s1 |
| InChIKey | NFZZVNCANALXPG-WKWVNEEDSA-N |
| XLogP | 5.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.63 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|