C15H26O3Si — CID 11558253
(3aR,4R,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-ethenyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 11558253) has the molecular formula C15H26O3Si and a molecular weight of 282.46 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-ethenyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-ethenyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 11558253 |
| Molecular Formula | C15H26O3Si |
| Molecular Weight | 282.46 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | (3aR,4R,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-ethenyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | C=C[C@@H]1[C@H]2CC(=O)O[C@H]2C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H26O3Si/c1-7-10-11-8-14(16)17-12(11)9-13(10)18-19(5,6)15(2,3)4/h7,10-13H,1,8-9H2,2-6H3/t10-,11-,12+,13-/m1/s1 |
| InChIKey | FYGJMHPHXZLLJS-FVCCEPFGSA-N |
| XLogP | 3.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|