C23H40O5Si2 — CID 154707116
(1S,6R,10R,12S)-10,12-bis[[tert-butyl(dimethyl)silyl]oxy]-8-oxatricyclo[4.3.3.01,6]dodec-3-ene-7,9-dione (PubChem CID 154707116) has the molecular formula C23H40O5Si2 and a molecular weight of 452.74 g/mol. Its IUPAC name is (1S,6R,10R,12S)-10,12-bis[[tert-butyl(dimethyl)silyl]oxy]-8-oxatricyclo[4.3.3.01,6]dodec-3-ene-7,9-dione.
| Compound Name | (1S,6R,10R,12S)-10,12-bis[[tert-butyl(dimethyl)silyl]oxy]-8-oxatricyclo[4.3.3.01,6]dodec-3-ene-7,9-dione |
|---|---|
| PubChem CID | 154707116 |
| Molecular Formula | C23H40O5Si2 |
| Molecular Weight | 452.74 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | (1S,6R,10R,12S)-10,12-bis[[tert-butyl(dimethyl)silyl]oxy]-8-oxatricyclo[4.3.3.01,6]dodec-3-ene-7,9-dione |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)[C@]23CC=CC[C@]12C(=O)OC3=O |
| InChI | InChI=1S/C23H40O5Si2/c1-20(2,3)29(7,8)27-16-15-17(28-30(9,10)21(4,5)6)23-14-12-11-13-22(16,23)18(24)26-19(23)25/h11-12,16-17H,13-15H2,1-10H3/t16-,17+,22+,23- |
| InChIKey | HVGYCQPJHWLYMU-HLYHAVAHSA-N |
| XLogP | 5.58 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.74 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|