C25H40O6Si — CID 134841529
ethyl (1R,3S,6R,9S)-9-[[(1R,6R)-6-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-yl]methoxy]-6-methyl-4-oxo-5-oxatricyclo[4.2.1.03,9]nonane-3-carboxylate (PubChem CID 134841529) has the molecular formula C25H40O6Si and a molecular weight of 464.68 g/mol. Its IUPAC name is ethyl (1R,3S,6R,9S)-9-[[(1R,6R)-6-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-yl]methoxy]-6-methyl-4-oxo-5-oxatricyclo[4.2.1.03,9]nonane-3-carboxylate.
| Compound Name | ethyl (1R,3S,6R,9S)-9-[[(1R,6R)-6-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-yl]methoxy]-6-methyl-4-oxo-5-oxatricyclo[4.2.1.03,9]nonane-3-carboxylate |
|---|---|
| PubChem CID | 134841529 |
| Molecular Formula | C25H40O6Si |
| Molecular Weight | 464.68 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | ethyl (1R,3S,6R,9S)-9-[[(1R,6R)-6-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-yl]methoxy]-6-methyl-4-oxo-5-oxatricyclo[4.2.1.03,9]nonane-3-carboxylate |
| SMILES | CCOC(=O)[C@@]12C[C@H]3CC[C@@](C)(OC1=O)[C@]32OC[C@H]1C=CCC[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H40O6Si/c1-8-28-20(26)24-15-18-13-14-23(5,30-21(24)27)25(18,24)29-16-17-11-9-10-12-19(17)31-32(6,7)22(2,3)4/h9,11,17-19H,8,10,12-16H2,1-7H3/t17-,18-,19-,23-,24+,25-/m1/s1 |
| InChIKey | IVAAKBGZIMLPCR-GZFIQXFKSA-N |
| XLogP | 4.78 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.68 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|