C22H36O4Si — CID 134841568
(1R,3S,6R,9S)-9-[[(1R,6R)-6-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-yl]methoxy]-6-methyl-5-oxatricyclo[4.2.1.03,9]nonan-4-one (PubChem CID 134841568) has the molecular formula C22H36O4Si and a molecular weight of 392.61 g/mol. Its IUPAC name is (1R,3S,6R,9S)-9-[[(1R,6R)-6-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-yl]methoxy]-6-methyl-5-oxatricyclo[4.2.1.03,9]nonan-4-one.
| Compound Name | (1R,3S,6R,9S)-9-[[(1R,6R)-6-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-yl]methoxy]-6-methyl-5-oxatricyclo[4.2.1.03,9]nonan-4-one |
|---|---|
| PubChem CID | 134841568 |
| Molecular Formula | C22H36O4Si |
| Molecular Weight | 392.61 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | (1R,3S,6R,9S)-9-[[(1R,6R)-6-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-yl]methoxy]-6-methyl-5-oxatricyclo[4.2.1.03,9]nonan-4-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CCC=C[C@@H]1CO[C@]12[C@@H]3CC[C@@]1(C)OC(=O)[C@H]2C3 |
| InChI | InChI=1S/C22H36O4Si/c1-20(2,3)27(5,6)26-18-10-8-7-9-15(18)14-24-22-16-11-12-21(22,4)25-19(23)17(22)13-16/h7,9,15-18H,8,10-14H2,1-6H3/t15-,16-,17-,18-,21-,22+/m1/s1 |
| InChIKey | NLFWNXLKECHHEI-MEILYROSSA-N |
| XLogP | 4.84 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.61 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|