C16H20O7 — CID 134839764
dimethyl (1R,2S)-4,5,5-triacetyl-3-methylcyclopent-3-ene-1,2-dicarboxylate (PubChem CID 134839764) has the molecular formula C16H20O7 and a molecular weight of 324.33 g/mol. Its IUPAC name is dimethyl (1R,2S)-4,5,5-triacetyl-3-methylcyclopent-3-ene-1,2-dicarboxylate.
| Compound Name | dimethyl (1R,2S)-4,5,5-triacetyl-3-methylcyclopent-3-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 134839764 |
| Molecular Formula | C16H20O7 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | dimethyl (1R,2S)-4,5,5-triacetyl-3-methylcyclopent-3-ene-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C(C)=C(C(C)=O)C(C(C)=O)(C(C)=O)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C16H20O7/c1-7-11(14(20)22-5)13(15(21)23-6)16(9(3)18,10(4)19)12(7)8(2)17/h11,13H,1-6H3/t11-,13+/m1/s1 |
| InChIKey | PWWNQZSTKPTVQL-YPMHNXCESA-N |
| XLogP | 0.65 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|