C18H18N4O — CID 134840261
[5-methyl-2,3-bis(4-methylphenyl)-1,3,4-oxadiazol-2-yl]cyanamide (PubChem CID 134840261) has the molecular formula C18H18N4O and a molecular weight of 306.37 g/mol. Its IUPAC name is [5-methyl-2,3-bis(4-methylphenyl)-1,3,4-oxadiazol-2-yl]cyanamide.
| Compound Name | [5-methyl-2,3-bis(4-methylphenyl)-1,3,4-oxadiazol-2-yl]cyanamide |
|---|---|
| PubChem CID | 134840261 |
| Molecular Formula | C18H18N4O |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | [5-methyl-2,3-bis(4-methylphenyl)-1,3,4-oxadiazol-2-yl]cyanamide |
| SMILES | CC1=NN(c2ccc(C)cc2)C(NC#N)(c2ccc(C)cc2)O1 |
| InChI | InChI=1S/C18H18N4O/c1-13-4-8-16(9-5-13)18(20-12-19)22(21-15(3)23-18)17-10-6-14(2)7-11-17/h4-11,20H,1-3H3 |
| InChIKey | IGXOHQMWBHXLEP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 60.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|