C20H21N3O — CID 139237691
5-methyl-N,3-diphenyl-2,6,7,8-tetrahydrocyclopenta[e][1,3,4]oxadiazepin-3-amine (PubChem CID 139237691) has the molecular formula C20H21N3O and a molecular weight of 319.41 g/mol. Its IUPAC name is 5-methyl-N,3-diphenyl-2,6,7,8-tetrahydrocyclopenta[e][1,3,4]oxadiazepin-3-amine.
| Compound Name | 5-methyl-N,3-diphenyl-2,6,7,8-tetrahydrocyclopenta[e][1,3,4]oxadiazepin-3-amine |
|---|---|
| PubChem CID | 139237691 |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 5-methyl-N,3-diphenyl-2,6,7,8-tetrahydrocyclopenta[e][1,3,4]oxadiazepin-3-amine |
| SMILES | CC1=C2CCCC2=NNC(Nc2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C20H21N3O/c1-15-18-13-8-14-19(18)22-23-20(24-15,16-9-4-2-5-10-16)21-17-11-6-3-7-12-17/h2-7,9-12,21,23H,8,13-14H2,1H3 |
| InChIKey | LOYNZIAVQHAPNG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |