C17H17N3O2 — CID 59956654
2,2-dimethyl-N,5-diphenyl-1,3,4-oxadiazole-3-carboxamide (PubChem CID 59956654) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is 2,2-dimethyl-N,5-diphenyl-1,3,4-oxadiazole-3-carboxamide.
| Compound Name | 2,2-dimethyl-N,5-diphenyl-1,3,4-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 59956654 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 2,2-dimethyl-N,5-diphenyl-1,3,4-oxadiazole-3-carboxamide |
| SMILES | CC1(C)OC(c2ccccc2)=NN1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C17H17N3O2/c1-17(2)20(16(21)18-14-11-7-4-8-12-14)19-15(22-17)13-9-5-3-6-10-13/h3-12H,1-2H3,(H,18,21) |
| InChIKey | NDEQFUCRTXZULM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |