C18H32O4Si — CID 134841707
(3E,5R,6R,7Z)-5-[tert-butyl(dimethyl)silyl]oxy-3,6,8-trimethyl-9-oxonona-3,7-dienoic acid (PubChem CID 134841707) has the molecular formula C18H32O4Si and a molecular weight of 340.54 g/mol. Its IUPAC name is (3E,5R,6R,7Z)-5-[tert-butyl(dimethyl)silyl]oxy-3,6,8-trimethyl-9-oxonona-3,7-dienoic acid.
| Compound Name | (3E,5R,6R,7Z)-5-[tert-butyl(dimethyl)silyl]oxy-3,6,8-trimethyl-9-oxonona-3,7-dienoic acid |
|---|---|
| PubChem CID | 134841707 |
| Molecular Formula | C18H32O4Si |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | (3E,5R,6R,7Z)-5-[tert-butyl(dimethyl)silyl]oxy-3,6,8-trimethyl-9-oxonona-3,7-dienoic acid |
| SMILES | C/C(C=O)=C/[C@@H](C)[C@H](/C=C(\C)CC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H32O4Si/c1-13(11-17(20)21)10-16(15(3)9-14(2)12-19)22-23(7,8)18(4,5)6/h9-10,12,15-16H,11H2,1-8H3,(H,20,21)/b13-10+,14-9-/t15-,16+/m1/s1 |
| InChIKey | MANSJPDPPMEYMU-KPDKVZNASA-N |
| XLogP | 4.58 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|