C17H32O4Si — CID 134841997
(2S)-5-[(4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-yn-2-ol (PubChem CID 134841997) has the molecular formula C17H32O4Si and a molecular weight of 328.53 g/mol. Its IUPAC name is (2S)-5-[(4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-yn-2-ol.
| Compound Name | (2S)-5-[(4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-yn-2-ol |
|---|---|
| PubChem CID | 134841997 |
| Molecular Formula | C17H32O4Si |
| Molecular Weight | 328.53 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | (2S)-5-[(4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-yn-2-ol |
| SMILES | C[C@H](O)CC#C[C@H]1OC(C)(C)O[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32O4Si/c1-13(18)10-9-11-14-15(21-17(5,6)20-14)12-19-22(7,8)16(2,3)4/h13-15,18H,10,12H2,1-8H3/t13-,14+,15-/m0/s1 |
| InChIKey | HCKZATMRNRPFPO-ZNMIVQPWSA-N |
| XLogP | 3.30 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.53 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|