C19H36O4Si — CID 102201983
1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hept-1-yn-3-ol (PubChem CID 102201983) has the molecular formula C19H36O4Si and a molecular weight of 356.58 g/mol. Its IUPAC name is 1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hept-1-yn-3-ol.
| Compound Name | 1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hept-1-yn-3-ol |
|---|---|
| PubChem CID | 102201983 |
| Molecular Formula | C19H36O4Si |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | 1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hept-1-yn-3-ol |
| SMILES | CCCCC(O)C#C[C@@H]1OC(C)(C)O[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H36O4Si/c1-9-10-11-15(20)12-13-16-17(23-19(5,6)22-16)14-21-24(7,8)18(2,3)4/h15-17,20H,9-11,14H2,1-8H3/t15?,16-,17-/m0/s1 |
| InChIKey | FVKHHWLNESBGJS-BSOSBYQFSA-N |
| XLogP | 4.08 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|