C25H44O6Si2 — CID 11329457
(3aR,4R,11R,11aR)-4,11-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-dimethyl-5,6,9,10-tetradehydro-3a,4,7,8,11,11a-hexahydrocyclodeca[d][1,3]dioxole-7,8-diol (PubChem CID 11329457) has the molecular formula C25H44O6Si2 and a molecular weight of 496.79 g/mol. Its IUPAC name is (3aR,4R,11R,11aR)-4,11-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-dimethyl-5,6,9,10-tetradehydro-3a,4,7,8,11,11a-hexahydrocyclodeca[d][1,3]dioxole-7,8-diol.
| Compound Name | (3aR,4R,11R,11aR)-4,11-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-dimethyl-5,6,9,10-tetradehydro-3a,4,7,8,11,11a-hexahydrocyclodeca[d][1,3]dioxole-7,8-diol |
|---|---|
| PubChem CID | 11329457 |
| Molecular Formula | C25H44O6Si2 |
| Molecular Weight | 496.79 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | (3aR,4R,11R,11aR)-4,11-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-dimethyl-5,6,9,10-tetradehydro-3a,4,7,8,11,11a-hexahydrocyclodeca[d][1,3]dioxole-7,8-diol |
| SMILES | CC1(C)O[C@@H]2[C@@H](O1)[C@H](O[Si](C)(C)C(C)(C)C)C#CC(O)C(O)C#C[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H44O6Si2/c1-23(2,3)32(9,10)30-19-15-13-17(26)18(27)14-16-20(31-33(11,12)24(4,5)6)22-21(19)28-25(7,8)29-22/h17-22,26-27H,1-12H3/t17?,18?,19-,20+,21-,22-/m0/s1 |
| InChIKey | CIYPEMROVUGYCN-UUUHCWRRSA-N |
| XLogP | 4.03 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.79 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|