C18H34O6Si — CID 102276240
[(2S,3R,5R,6R)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-ynyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]methanol (PubChem CID 102276240) has the molecular formula C18H34O6Si and a molecular weight of 374.55 g/mol. Its IUPAC name is [(2S,3R,5R,6R)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-ynyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]methanol.
| Compound Name | [(2S,3R,5R,6R)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-ynyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]methanol |
|---|---|
| PubChem CID | 102276240 |
| Molecular Formula | C18H34O6Si |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | [(2S,3R,5R,6R)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-ynyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]methanol |
| SMILES | C#C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@@](C)(OC)[C@](C)(OC)O[C@H]1CO |
| InChI | InChI=1S/C18H34O6Si/c1-11-13(24-25(9,10)16(2,3)4)15-14(12-19)22-17(5,20-7)18(6,21-8)23-15/h1,13-15,19H,12H2,2-10H3/t13-,14-,15-,17+,18+/m0/s1 |
| InChIKey | LWSFNHHITNMCMV-OLEVXBPZSA-N |
| XLogP | 2.51 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|