C21H38O5Si — CID 102201982
[(3S)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hept-1-yn-3-yl] acetate (PubChem CID 102201982) has the molecular formula C21H38O5Si and a molecular weight of 398.62 g/mol. Its IUPAC name is [(3S)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hept-1-yn-3-yl] acetate.
| Compound Name | [(3S)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hept-1-yn-3-yl] acetate |
|---|---|
| PubChem CID | 102201982 |
| Molecular Formula | C21H38O5Si |
| Molecular Weight | 398.62 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | [(3S)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hept-1-yn-3-yl] acetate |
| SMILES | CCCC[C@@H](C#C[C@@H]1OC(C)(C)O[C@H]1CO[Si](C)(C)C(C)(C)C)OC(C)=O |
| InChI | InChI=1S/C21H38O5Si/c1-10-11-12-17(24-16(2)22)13-14-18-19(26-21(6,7)25-18)15-23-27(8,9)20(3,4)5/h17-19H,10-12,15H2,1-9H3/t17-,18-,19-/m0/s1 |
| InChIKey | UBIQABYUADPCTL-FHWLQOOXSA-N |
| XLogP | 4.65 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.62 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|