C25H42O6Si2 — CID 11202744
(4R)-4-[tert-butyl(dimethyl)silyl]oxy-4-[(4R,5R)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-4-oxobut-2-ynyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-ynal (PubChem CID 11202744) has the molecular formula C25H42O6Si2 and a molecular weight of 494.78 g/mol. Its IUPAC name is (4R)-4-[tert-butyl(dimethyl)silyl]oxy-4-[(4R,5R)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-4-oxobut-2-ynyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-ynal.
| Compound Name | (4R)-4-[tert-butyl(dimethyl)silyl]oxy-4-[(4R,5R)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-4-oxobut-2-ynyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-ynal |
|---|---|
| PubChem CID | 11202744 |
| Molecular Formula | C25H42O6Si2 |
| Molecular Weight | 494.78 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | (4R)-4-[tert-butyl(dimethyl)silyl]oxy-4-[(4R,5R)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-4-oxobut-2-ynyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-ynal |
| SMILES | CC1(C)O[C@@H]([C@@H](C#CC=O)O[Si](C)(C)C(C)(C)C)[C@H]([C@@H](C#CC=O)O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C25H42O6Si2/c1-23(2,3)32(9,10)30-19(15-13-17-26)21-22(29-25(7,8)28-21)20(16-14-18-27)31-33(11,12)24(4,5)6/h17-22H,1-12H3/t19-,20-,21+,22+/m1/s1 |
| InChIKey | MFPFLQCPEHVSME-CZYKHXBRSA-N |
| XLogP | 4.69 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.78 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|