C21H19NO5Se — CID 134842125
benzyl (3aR,5S,6aR)-2-oxo-5-phenylselanylcarbonyl-3a,5,6,6a-tetrahydro-3H-furo[3,2-b]pyrrole-4-carboxylate (PubChem CID 134842125) has the molecular formula C21H19NO5Se and a molecular weight of 444.35 g/mol. Its IUPAC name is benzyl (3aR,5S,6aR)-2-oxo-5-phenylselanylcarbonyl-3a,5,6,6a-tetrahydro-3H-furo[3,2-b]pyrrole-4-carboxylate.
| Compound Name | benzyl (3aR,5S,6aR)-2-oxo-5-phenylselanylcarbonyl-3a,5,6,6a-tetrahydro-3H-furo[3,2-b]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 134842125 |
| Molecular Formula | C21H19NO5Se |
| Molecular Weight | 444.35 g/mol |
| Exact Mass | 445.04 |
| IUPAC Name | benzyl (3aR,5S,6aR)-2-oxo-5-phenylselanylcarbonyl-3a,5,6,6a-tetrahydro-3H-furo[3,2-b]pyrrole-4-carboxylate |
| SMILES | O=C1C[C@@H]2[C@@H](C[C@@H](C(=O)[Se]c3ccccc3)N2C(=O)OCc2ccccc2)O1 |
| InChI | InChI=1S/C21H19NO5Se/c23-19-12-16-18(27-19)11-17(20(24)28-15-9-5-2-6-10-15)22(16)21(25)26-13-14-7-3-1-4-8-14/h1-10,16-18H,11-13H2/t16-,17+,18-/m1/s1 |
| InChIKey | COXQJEAAYIDUSJ-FGTMMUONSA-N |
| XLogP | 1.64 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|