C17H14O3S — CID 134842241
methyl (3R)-2-methylidene-3-phenyl-5-thiophen-2-yl-3H-furan-4-carboxylate (PubChem CID 134842241) has the molecular formula C17H14O3S and a molecular weight of 298.36 g/mol. Its IUPAC name is methyl (3R)-2-methylidene-3-phenyl-5-thiophen-2-yl-3H-furan-4-carboxylate.
| Compound Name | methyl (3R)-2-methylidene-3-phenyl-5-thiophen-2-yl-3H-furan-4-carboxylate |
|---|---|
| PubChem CID | 134842241 |
| Molecular Formula | C17H14O3S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | methyl (3R)-2-methylidene-3-phenyl-5-thiophen-2-yl-3H-furan-4-carboxylate |
| SMILES | C=C1OC(c2cccs2)=C(C(=O)OC)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H14O3S/c1-11-14(12-7-4-3-5-8-12)15(17(18)19-2)16(20-11)13-9-6-10-21-13/h3-10,14H,1H2,2H3/t14-/m1/s1 |
| InChIKey | UTSOOEMFIVNRAU-CQSZACIVSA-N |
| XLogP | 3.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |