C10H16N2O — CID 134842991
(5S)-10-methyl-1,10-diazaspiro[4.6]undec-8-en-11-one (PubChem CID 134842991) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is (5S)-10-methyl-1,10-diazaspiro[4.6]undec-8-en-11-one.
| Compound Name | (5S)-10-methyl-1,10-diazaspiro[4.6]undec-8-en-11-one |
|---|---|
| PubChem CID | 134842991 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | (5S)-10-methyl-1,10-diazaspiro[4.6]undec-8-en-11-one |
| SMILES | CN1C=CCC[C@]2(CCCN2)C1=O |
| InChI | InChI=1S/C10H16N2O/c1-12-8-3-2-5-10(9(12)13)6-4-7-11-10/h3,8,11H,2,4-7H2,1H3/t10-/m0/s1 |
| InChIKey | YKUVSIXIRJIXFL-JTQLQIEISA-N |
| XLogP | 0.87 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |