C13H17IN2O2S — CID 144678598
2-(4-methoxyphenyl)-2,5-diazaspiro[3.4]octan-3-one;thiohypoiodous acid (PubChem CID 144678598) has the molecular formula C13H17IN2O2S and a molecular weight of 392.26 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-2,5-diazaspiro[3.4]octan-3-one;thiohypoiodous acid.
| Compound Name | 2-(4-methoxyphenyl)-2,5-diazaspiro[3.4]octan-3-one;thiohypoiodous acid |
|---|---|
| PubChem CID | 144678598 |
| Molecular Formula | C13H17IN2O2S |
| Molecular Weight | 392.26 g/mol |
| Exact Mass | 392.01 |
| IUPAC Name | 2-(4-methoxyphenyl)-2,5-diazaspiro[3.4]octan-3-one;thiohypoiodous acid |
| SMILES | COc1ccc(N2CC3(CCCN3)C2=O)cc1.SI |
| InChI | InChI=1S/C13H16N2O2.HIS/c1-17-11-5-3-10(4-6-11)15-9-13(12(15)16)7-2-8-14-13;1-2/h3-6,14H,2,7-9H2,1H3;2H |
| InChIKey | RNERBYSBEKVCGP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|