C13H16N2O2S — CID 141310644
5-(4-methoxyphenyl)-6-sulfanyl-5,7-diazaspiro[3.4]octan-8-one (PubChem CID 141310644) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-6-sulfanyl-5,7-diazaspiro[3.4]octan-8-one.
| Compound Name | 5-(4-methoxyphenyl)-6-sulfanyl-5,7-diazaspiro[3.4]octan-8-one |
|---|---|
| PubChem CID | 141310644 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 5-(4-methoxyphenyl)-6-sulfanyl-5,7-diazaspiro[3.4]octan-8-one |
| SMILES | COc1ccc(N2C(S)NC(=O)C23CCC3)cc1 |
| InChI | InChI=1S/C13H16N2O2S/c1-17-10-5-3-9(4-6-10)15-12(18)14-11(16)13(15)7-2-8-13/h3-6,12,18H,2,7-8H2,1H3,(H,14,16) |
| InChIKey | MBXHDHHXHOZJPA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|