C10H8Cl2N2O3 — CID 141228935
5,5-dichloro-1-(4-methoxyphenyl)imidazolidine-2,4-dione (PubChem CID 141228935) has the molecular formula C10H8Cl2N2O3 and a molecular weight of 275.09 g/mol. Its IUPAC name is 5,5-dichloro-1-(4-methoxyphenyl)imidazolidine-2,4-dione.
| Compound Name | 5,5-dichloro-1-(4-methoxyphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 141228935 |
| Molecular Formula | C10H8Cl2N2O3 |
| Molecular Weight | 275.09 g/mol |
| Exact Mass | 273.99 |
| IUPAC Name | 5,5-dichloro-1-(4-methoxyphenyl)imidazolidine-2,4-dione |
| SMILES | COc1ccc(N2C(=O)NC(=O)C2(Cl)Cl)cc1 |
| InChI | InChI=1S/C10H8Cl2N2O3/c1-17-7-4-2-6(3-5-7)14-9(16)13-8(15)10(14,11)12/h2-5H,1H3,(H,13,15,16) |
| InChIKey | FUYPJILLWHKFKK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.09 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|