C11H9Cl2NO3 — CID 101046905
(2S)-3,3-dichloro-1-(4-methoxyphenyl)-4-oxoazetidine-2-carbaldehyde (PubChem CID 101046905) has the molecular formula C11H9Cl2NO3 and a molecular weight of 274.10 g/mol. Its IUPAC name is (2S)-3,3-dichloro-1-(4-methoxyphenyl)-4-oxoazetidine-2-carbaldehyde.
| Compound Name | (2S)-3,3-dichloro-1-(4-methoxyphenyl)-4-oxoazetidine-2-carbaldehyde |
|---|---|
| PubChem CID | 101046905 |
| Molecular Formula | C11H9Cl2NO3 |
| Molecular Weight | 274.10 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | (2S)-3,3-dichloro-1-(4-methoxyphenyl)-4-oxoazetidine-2-carbaldehyde |
| SMILES | COc1ccc(N2C(=O)C(Cl)(Cl)[C@@H]2C=O)cc1 |
| InChI | InChI=1S/C11H9Cl2NO3/c1-17-8-4-2-7(3-5-8)14-9(6-15)11(12,13)10(14)16/h2-6,9H,1H3/t9-/m0/s1 |
| InChIKey | MDKZVVKKMSJAPO-VIFPVBQESA-N |
| XLogP | 1.78 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.10 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|