C11H13N3O3 — CID 44509447
6-amino-1-(4-methoxyphenyl)-1,3-diazinane-2,4-dione (PubChem CID 44509447) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is 6-amino-1-(4-methoxyphenyl)-1,3-diazinane-2,4-dione.
| Compound Name | 6-amino-1-(4-methoxyphenyl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 44509447 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 6-amino-1-(4-methoxyphenyl)-1,3-diazinane-2,4-dione |
| SMILES | COc1ccc(N2C(=O)NC(=O)CC2N)cc1 |
| InChI | InChI=1S/C11H13N3O3/c1-17-8-4-2-7(3-5-8)14-9(12)6-10(15)13-11(14)16/h2-5,9H,6,12H2,1H3,(H,13,15,16) |
| InChIKey | FMNVSILQOVAXPS-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |