C11H12BrNO3 — CID 10891443
(4S,5R)-4-bromo-5-hydroxy-1-(4-methoxyphenyl)pyrrolidin-2-one (PubChem CID 10891443) has the molecular formula C11H12BrNO3 and a molecular weight of 286.13 g/mol. Its IUPAC name is (4S,5R)-4-bromo-5-hydroxy-1-(4-methoxyphenyl)pyrrolidin-2-one.
| Compound Name | (4S,5R)-4-bromo-5-hydroxy-1-(4-methoxyphenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 10891443 |
| Molecular Formula | C11H12BrNO3 |
| Molecular Weight | 286.13 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | (4S,5R)-4-bromo-5-hydroxy-1-(4-methoxyphenyl)pyrrolidin-2-one |
| SMILES | COc1ccc(N2C(=O)C[C@H](Br)[C@H]2O)cc1 |
| InChI | InChI=1S/C11H12BrNO3/c1-16-8-4-2-7(3-5-8)13-10(14)6-9(12)11(13)15/h2-5,9,11,15H,6H2,1H3/t9-,11+/m0/s1 |
| InChIKey | ZYIFMKQIDKIGFL-GXSJLCMTSA-N |
| XLogP | 1.51 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.13 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|