C15H21O6+ — CID 134843380
[(2R,3S,6S)-3-acetyloxy-6-cyclopentyloxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 134843380) has the molecular formula C15H21O6+ and a molecular weight of 297.33 g/mol. Its IUPAC name is [(2R,3S,6S)-3-acetyloxy-6-cyclopentyloxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2R,3S,6S)-3-acetyloxy-6-cyclopentyloxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134843380 |
| Molecular Formula | C15H21O6+ |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | [(2R,3S,6S)-3-acetyloxy-6-cyclopentyloxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](OC2C[CH+]CC2)C=C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C15H21O6/c1-10(16)18-9-14-13(19-11(2)17)7-8-15(21-14)20-12-5-3-4-6-12/h3,7-8,12-15H,4-6,9H2,1-2H3/q+1/t12?,13-,14+,15-/m0/s1 |
| InChIKey | MUNROSSJWXZGOP-DKUMPPAJSA-N |
| XLogP | 1.54 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|