C19H20BrNO6 — CID 134843910
trimethyl 1-(4-bromophenyl)-2,6-dimethyl-4H-pyridine-3,4,5-tricarboxylate (PubChem CID 134843910) has the molecular formula C19H20BrNO6 and a molecular weight of 438.27 g/mol. Its IUPAC name is trimethyl 1-(4-bromophenyl)-2,6-dimethyl-4H-pyridine-3,4,5-tricarboxylate.
| Compound Name | trimethyl 1-(4-bromophenyl)-2,6-dimethyl-4H-pyridine-3,4,5-tricarboxylate |
|---|---|
| PubChem CID | 134843910 |
| Molecular Formula | C19H20BrNO6 |
| Molecular Weight | 438.27 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | trimethyl 1-(4-bromophenyl)-2,6-dimethyl-4H-pyridine-3,4,5-tricarboxylate |
| SMILES | COC(=O)C1=C(C)N(c2ccc(Br)cc2)C(C)=C(C(=O)OC)C1C(=O)OC |
| InChI | InChI=1S/C19H20BrNO6/c1-10-14(17(22)25-3)16(19(24)27-5)15(18(23)26-4)11(2)21(10)13-8-6-12(20)7-9-13/h6-9,16H,1-5H3 |
| InChIKey | VXWVRSQVYYNSCE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.27 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|