C22H29NO6 — CID 134844345
tert-butyl (4aR,7R,7aR)-7-(1,3-benzodioxol-5-ylmethyl)-7a-hydroxy-1-methyl-2-oxo-4,5,6,7-tetrahydro-3H-cyclopenta[b]pyridine-4a-carboxylate (PubChem CID 134844345) has the molecular formula C22H29NO6 and a molecular weight of 403.48 g/mol. Its IUPAC name is tert-butyl (4aR,7R,7aR)-7-(1,3-benzodioxol-5-ylmethyl)-7a-hydroxy-1-methyl-2-oxo-4,5,6,7-tetrahydro-3H-cyclopenta[b]pyridine-4a-carboxylate.
| Compound Name | tert-butyl (4aR,7R,7aR)-7-(1,3-benzodioxol-5-ylmethyl)-7a-hydroxy-1-methyl-2-oxo-4,5,6,7-tetrahydro-3H-cyclopenta[b]pyridine-4a-carboxylate |
|---|---|
| PubChem CID | 134844345 |
| Molecular Formula | C22H29NO6 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | tert-butyl (4aR,7R,7aR)-7-(1,3-benzodioxol-5-ylmethyl)-7a-hydroxy-1-methyl-2-oxo-4,5,6,7-tetrahydro-3H-cyclopenta[b]pyridine-4a-carboxylate |
| SMILES | CN1C(=O)CC[C@]2(C(=O)OC(C)(C)C)CC[C@H](Cc3ccc4c(c3)OCO4)[C@]12O |
| InChI | InChI=1S/C22H29NO6/c1-20(2,3)29-19(25)21-9-7-15(22(21,26)23(4)18(24)8-10-21)11-14-5-6-16-17(12-14)28-13-27-16/h5-6,12,15,26H,7-11,13H2,1-4H3/t15-,21+,22-/m1/s1 |
| InChIKey | QAEJJKVAKSPTHE-KBJGYGKASA-N |
| XLogP | 2.64 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |