C33H40O14S3 — CID 134844701
[(3S,4R,6R)-6-acetyloxy-3-[(2S,5R)-5-acetyloxy-6-methyl-4-methylsulfanylcarbonyloxy-3-phenylsulfanyloxan-2-yl]oxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-4-yl] acetate (PubChem CID 134844701) has the molecular formula C33H40O14S3 and a molecular weight of 756.87 g/mol. Its IUPAC name is [(3S,4R,6R)-6-acetyloxy-3-[(2S,5R)-5-acetyloxy-6-methyl-4-methylsulfanylcarbonyloxy-3-phenylsulfanyloxan-2-yl]oxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-4-yl] acetate.
| Compound Name | [(3S,4R,6R)-6-acetyloxy-3-[(2S,5R)-5-acetyloxy-6-methyl-4-methylsulfanylcarbonyloxy-3-phenylsulfanyloxan-2-yl]oxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-4-yl] acetate |
|---|---|
| PubChem CID | 134844701 |
| Molecular Formula | C33H40O14S3 |
| Molecular Weight | 756.87 g/mol |
| Exact Mass | 756.16 |
| IUPAC Name | [(3S,4R,6R)-6-acetyloxy-3-[(2S,5R)-5-acetyloxy-6-methyl-4-methylsulfanylcarbonyloxy-3-phenylsulfanyloxan-2-yl]oxy-2-[(4-methylphenyl)sulfonyloxymethyl]oxan-4-yl] acetate |
| SMILES | CSC(=O)OC1C(Sc2ccccc2)[C@H](O[C@@H]2C(COS(=O)(=O)c3ccc(C)cc3)O[C@H](OC(C)=O)C[C@H]2OC(C)=O)OC(C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C33H40O14S3/c1-18-12-14-24(15-13-18)50(38,39)40-17-26-29(25(42-20(3)34)16-27(45-26)43-21(4)35)46-32-31(49-23-10-8-7-9-11-23)30(47-33(37)48-6)28(19(2)41-32)44-22(5)36/h7-15,19,25-32H,16-17H2,1-6H3/t19?,25-,26?,27+,28-,29+,30?,31?,32+/m1/s1 |
| InChIKey | FZADYSFWRHHVSJ-YGHGIOCASA-N |
| XLogP | 4.40 |
| TPSA | 176.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.87 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|