C39H54O7Si — CID 134844889
[(1R,2R,4S,7R,9S,10R,14R,19R)-11-formyl-1,10,19-trimethyl-8-oxo-16-propan-2-yl-9-triethylsilyloxy-3,5-dioxapentacyclo[12.7.0.02,10.04,9.015,19]henicosa-11,15-dien-7-yl] benzoate (PubChem CID 134844889) has the molecular formula C39H54O7Si and a molecular weight of 662.94 g/mol. Its IUPAC name is [(1R,2R,4S,7R,9S,10R,14R,19R)-11-formyl-1,10,19-trimethyl-8-oxo-16-propan-2-yl-9-triethylsilyloxy-3,5-dioxapentacyclo[12.7.0.02,10.04,9.015,19]henicosa-11,15-dien-7-yl] benzoate.
| Compound Name | [(1R,2R,4S,7R,9S,10R,14R,19R)-11-formyl-1,10,19-trimethyl-8-oxo-16-propan-2-yl-9-triethylsilyloxy-3,5-dioxapentacyclo[12.7.0.02,10.04,9.015,19]henicosa-11,15-dien-7-yl] benzoate |
|---|---|
| PubChem CID | 134844889 |
| Molecular Formula | C39H54O7Si |
| Molecular Weight | 662.94 g/mol |
| Exact Mass | 662.36 |
| IUPAC Name | [(1R,2R,4S,7R,9S,10R,14R,19R)-11-formyl-1,10,19-trimethyl-8-oxo-16-propan-2-yl-9-triethylsilyloxy-3,5-dioxapentacyclo[12.7.0.02,10.04,9.015,19]henicosa-11,15-dien-7-yl] benzoate |
| SMILES | CC[Si](CC)(CC)O[C@]12C(=O)[C@H](OC(=O)c3ccccc3)CO[C@H]1O[C@@H]1[C@]3(C)CC[C@@]4(C)CCC(C(C)C)=C4[C@H]3CC=C(C=O)[C@]12C |
| InChI | InChI=1S/C39H54O7Si/c1-9-47(10-2,11-3)46-39-32(41)30(44-33(42)26-15-13-12-14-16-26)24-43-35(39)45-34-37(7)22-21-36(6)20-19-28(25(4)5)31(36)29(37)18-17-27(23-40)38(34,39)8/h12-17,23,25,29-30,34-35H,9-11,18-22,24H2,1-8H3/t29-,30-,34-,35+,36-,37-,38-,39-/m1/s1 |
| InChIKey | NTGMQSHRBMTFBV-CMIJYRHFSA-N |
| XLogP | 8.00 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.94 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|