C15H21O8+ — CID 134844892
[(2S,3S,4S,5R)-3,4,5-triacetyloxyhept-6-en-2-yl] acetate (PubChem CID 134844892) has the molecular formula C15H21O8+ and a molecular weight of 329.33 g/mol. Its IUPAC name is [(2S,3S,4S,5R)-3,4,5-triacetyloxyhept-6-en-2-yl] acetate.
| Compound Name | [(2S,3S,4S,5R)-3,4,5-triacetyloxyhept-6-en-2-yl] acetate |
|---|---|
| PubChem CID | 134844892 |
| Molecular Formula | C15H21O8+ |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | [(2S,3S,4S,5R)-3,4,5-triacetyloxyhept-6-en-2-yl] acetate |
| SMILES | [H]/[C+]=C/[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](C)OC(C)=O |
| InChI | InChI=1S/C15H21O8/c1-7-13(21-10(4)17)15(23-12(6)19)14(22-11(5)18)8(2)20-9(3)16/h1,7-8,13-15H,2-6H3/q+1/t8-,13+,14-,15-/m0/s1 |
| InChIKey | YKHACZFPXRKDFG-IAXYGJIASA-N |
| XLogP | 0.72 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|