C15H18N2O5 — CID 134845448
(5R,7R)-8,9-dihydroxy-7-(phenylmethoxymethyl)-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 134845448) has the molecular formula C15H18N2O5 and a molecular weight of 306.32 g/mol. Its IUPAC name is (5R,7R)-8,9-dihydroxy-7-(phenylmethoxymethyl)-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | (5R,7R)-8,9-dihydroxy-7-(phenylmethoxymethyl)-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 134845448 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | (5R,7R)-8,9-dihydroxy-7-(phenylmethoxymethyl)-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | O=C1NC(=O)[C@]2(C[C@H](COCc3ccccc3)C(O)C2O)N1 |
| InChI | InChI=1S/C15H18N2O5/c18-11-10(8-22-7-9-4-2-1-3-5-9)6-15(12(11)19)13(20)16-14(21)17-15/h1-5,10-12,18-19H,6-8H2,(H2,16,17,20,21)/t10-,11?,12?,15-/m1/s1 |
| InChIKey | FWMZFJPYDGFWTK-TVRADYJESA-N |
| XLogP | -0.48 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|