C11H13BF3KO — CID 135036909
potassium trifluoro-[(1R,2R)-2-(phenylmethoxymethyl)cyclopropyl]boranuide (PubChem CID 135036909) has the molecular formula C11H13BF3KO and a molecular weight of 268.13 g/mol. Its IUPAC name is potassium trifluoro-[(1R,2R)-2-(phenylmethoxymethyl)cyclopropyl]boranuide.
| Compound Name | potassium trifluoro-[(1R,2R)-2-(phenylmethoxymethyl)cyclopropyl]boranuide |
|---|---|
| PubChem CID | 135036909 |
| Molecular Formula | C11H13BF3KO |
| Molecular Weight | 268.13 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | potassium trifluoro-[(1R,2R)-2-(phenylmethoxymethyl)cyclopropyl]boranuide |
| SMILES | F[B-](F)(F)[C@@H]1C[C@H]1COCc1ccccc1.[K+] |
| InChI | InChI=1S/C11H13BF3O.K/c13-12(14,15)11-6-10(11)8-16-7-9-4-2-1-3-5-9;/h1-5,10-11H,6-8H2;/q-1;+1/t10-,11+;/m0./s1 |
| InChIKey | CBRIUORUWGJGCI-VZXYPILPSA-N |
| XLogP | 0.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.13 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|