C10H11BF3K — CID 23711838
potassium [(1S,2S)-2-benzylcyclopropyl]-trifluoroboranuide (PubChem CID 23711838) has the molecular formula C10H11BF3K and a molecular weight of 238.10 g/mol. Its IUPAC name is potassium [(1S,2S)-2-benzylcyclopropyl]-trifluoroboranuide.
| Compound Name | potassium [(1S,2S)-2-benzylcyclopropyl]-trifluoroboranuide |
|---|---|
| PubChem CID | 23711838 |
| Molecular Formula | C10H11BF3K |
| Molecular Weight | 238.10 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | potassium [(1S,2S)-2-benzylcyclopropyl]-trifluoroboranuide |
| SMILES | F[B-](F)(F)[C@H]1C[C@H]1Cc1ccccc1.[K+] |
| InChI | InChI=1S/C10H11BF3.K/c12-11(13,14)10-7-9(10)6-8-4-2-1-3-5-8;/h1-5,9-10H,6-7H2;/q-1;+1/t9-,10+;/m1./s1 |
| InChIKey | NJARARQPAWGMPB-UXQCFNEQSA-N |
| XLogP | 0.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.10 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|