C19H14F3NO3 — CID 134845568
2-[(3S,4S)-4-[4-(trifluoromethyl)phenyl]oxolan-3-yl]isoindole-1,3-dione (PubChem CID 134845568) has the molecular formula C19H14F3NO3 and a molecular weight of 361.32 g/mol. Its IUPAC name is 2-[(3S,4S)-4-[4-(trifluoromethyl)phenyl]oxolan-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[(3S,4S)-4-[4-(trifluoromethyl)phenyl]oxolan-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 134845568 |
| Molecular Formula | C19H14F3NO3 |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 2-[(3S,4S)-4-[4-(trifluoromethyl)phenyl]oxolan-3-yl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1[C@@H]1COC[C@H]1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H14F3NO3/c20-19(21,22)12-7-5-11(6-8-12)15-9-26-10-16(15)23-17(24)13-3-1-2-4-14(13)18(23)25/h1-8,15-16H,9-10H2/t15-,16+/m0/s1 |
| InChIKey | WEDNNWHOUOFMJG-JKSUJKDBSA-N |
| XLogP | 3.48 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|