C22H44O3Si2 — CID 134845961
(2R,3R,4E,6E)-3,8-bis[[tert-butyl(dimethyl)silyl]oxy]-2,5-dimethylocta-4,6-dienal (PubChem CID 134845961) has the molecular formula C22H44O3Si2 and a molecular weight of 412.76 g/mol. Its IUPAC name is (2R,3R,4E,6E)-3,8-bis[[tert-butyl(dimethyl)silyl]oxy]-2,5-dimethylocta-4,6-dienal.
| Compound Name | (2R,3R,4E,6E)-3,8-bis[[tert-butyl(dimethyl)silyl]oxy]-2,5-dimethylocta-4,6-dienal |
|---|---|
| PubChem CID | 134845961 |
| Molecular Formula | C22H44O3Si2 |
| Molecular Weight | 412.76 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | (2R,3R,4E,6E)-3,8-bis[[tert-butyl(dimethyl)silyl]oxy]-2,5-dimethylocta-4,6-dienal |
| SMILES | CC(/C=C/CO[Si](C)(C)C(C)(C)C)=C\[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C=O |
| InChI | InChI=1S/C22H44O3Si2/c1-18(14-13-15-24-26(9,10)21(3,4)5)16-20(19(2)17-23)25-27(11,12)22(6,7)8/h13-14,16-17,19-20H,15H2,1-12H3/b14-13+,18-16+/t19-,20+/m0/s1 |
| InChIKey | SYHPXTDEOAEQEN-XZELOSRMSA-N |
| XLogP | 6.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.76 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|