C18H21F3O6S — CID 134846154
(2,3,8-trimethoxy-6-methyl-4-propan-2-ylnaphthalen-1-yl) trifluoromethanesulfonate (PubChem CID 134846154) has the molecular formula C18H21F3O6S and a molecular weight of 422.42 g/mol. Its IUPAC name is (2,3,8-trimethoxy-6-methyl-4-propan-2-ylnaphthalen-1-yl) trifluoromethanesulfonate.
| Compound Name | (2,3,8-trimethoxy-6-methyl-4-propan-2-ylnaphthalen-1-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134846154 |
| Molecular Formula | C18H21F3O6S |
| Molecular Weight | 422.42 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | (2,3,8-trimethoxy-6-methyl-4-propan-2-ylnaphthalen-1-yl) trifluoromethanesulfonate |
| SMILES | COc1c(OC)c(OS(=O)(=O)C(F)(F)F)c2c(OC)cc(C)cc2c1C(C)C |
| InChI | InChI=1S/C18H21F3O6S/c1-9(2)13-11-7-10(3)8-12(24-4)14(11)16(17(26-6)15(13)25-5)27-28(22,23)18(19,20)21/h7-9H,1-6H3 |
| InChIKey | AENYOMJVOUIXCD-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.42 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|