C16H29N3O — CID 134846480
N-hexyl-3,5-dipropylpyrazole-1-carboxamide (PubChem CID 134846480) has the molecular formula C16H29N3O and a molecular weight of 279.43 g/mol. Its IUPAC name is N-hexyl-3,5-dipropylpyrazole-1-carboxamide.
| Compound Name | N-hexyl-3,5-dipropylpyrazole-1-carboxamide |
|---|---|
| PubChem CID | 134846480 |
| Molecular Formula | C16H29N3O |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.23 |
| IUPAC Name | N-hexyl-3,5-dipropylpyrazole-1-carboxamide |
| SMILES | CCCCCCNC(=O)n1nc(CCC)cc1CCC |
| InChI | InChI=1S/C16H29N3O/c1-4-7-8-9-12-17-16(20)19-15(11-6-3)13-14(18-19)10-5-2/h13H,4-12H2,1-3H3,(H,17,20) |
| InChIKey | OACIDKYLXZMJJS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|