C32H55NO3Si — CID 134847008
(3R)-1-[(2R,3R,7S)-2-[(E)-2-[tert-butyl(dimethyl)silyl]oxyethenyl]-7-ethyl-3-methylazecan-1-yl]-3-methyl-4-phenylmethoxybutan-1-one (PubChem CID 134847008) has the molecular formula C32H55NO3Si and a molecular weight of 529.88 g/mol. Its IUPAC name is (3R)-1-[(2R,3R,7S)-2-[(E)-2-[tert-butyl(dimethyl)silyl]oxyethenyl]-7-ethyl-3-methylazecan-1-yl]-3-methyl-4-phenylmethoxybutan-1-one.
| Compound Name | (3R)-1-[(2R,3R,7S)-2-[(E)-2-[tert-butyl(dimethyl)silyl]oxyethenyl]-7-ethyl-3-methylazecan-1-yl]-3-methyl-4-phenylmethoxybutan-1-one |
|---|---|
| PubChem CID | 134847008 |
| Molecular Formula | C32H55NO3Si |
| Molecular Weight | 529.88 g/mol |
| Exact Mass | 529.40 |
| IUPAC Name | (3R)-1-[(2R,3R,7S)-2-[(E)-2-[tert-butyl(dimethyl)silyl]oxyethenyl]-7-ethyl-3-methylazecan-1-yl]-3-methyl-4-phenylmethoxybutan-1-one |
| SMILES | CC[C@H]1CCC[C@@H](C)[C@H](/C=C/O[Si](C)(C)C(C)(C)C)N(C(=O)C[C@@H](C)COCc2ccccc2)CCC1 |
| InChI | InChI=1S/C32H55NO3Si/c1-9-28-18-13-15-27(3)30(20-22-36-37(7,8)32(4,5)6)33(21-14-19-28)31(34)23-26(2)24-35-25-29-16-11-10-12-17-29/h10-12,16-17,20,22,26-28,30H,9,13-15,18-19,21,23-25H2,1-8H3/b22-20+/t26-,27-,28+,30+/m1/s1 |
| InChIKey | CKASSJMSVQQMPS-HEWRILIMSA-N |
| XLogP | 8.59 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.88 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|