C41H66N2O3Si — CID 45277882
5-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-hex-5-enyl-3,6-dihydro-2H-pyridin-4-yl]-3-hex-5-enyl-1-(5-phenylmethoxypentyl)-3,4-dihydropyridin-2-one (PubChem CID 45277882) has the molecular formula C41H66N2O3Si and a molecular weight of 663.08 g/mol. Its IUPAC name is 5-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-hex-5-enyl-3,6-dihydro-2H-pyridin-4-yl]-3-hex-5-enyl-1-(5-phenylmethoxypentyl)-3,4-dihydropyridin-2-one.
| Compound Name | 5-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-hex-5-enyl-3,6-dihydro-2H-pyridin-4-yl]-3-hex-5-enyl-1-(5-phenylmethoxypentyl)-3,4-dihydropyridin-2-one |
|---|---|
| PubChem CID | 45277882 |
| Molecular Formula | C41H66N2O3Si |
| Molecular Weight | 663.08 g/mol |
| Exact Mass | 662.48 |
| IUPAC Name | 5-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-hex-5-enyl-3,6-dihydro-2H-pyridin-4-yl]-3-hex-5-enyl-1-(5-phenylmethoxypentyl)-3,4-dihydropyridin-2-one |
| SMILES | C=CCCCCC1CC(C2=C(CO[Si](C)(C)C(C)(C)C)CN(CCCCC=C)CC2)=CN(CCCCCOCc2ccccc2)C1=O |
| InChI | InChI=1S/C41H66N2O3Si/c1-8-10-12-18-24-36-30-37(32-43(40(36)44)27-20-15-21-29-45-33-35-22-16-14-17-23-35)39-25-28-42(26-19-13-11-9-2)31-38(39)34-46-47(6,7)41(3,4)5/h8-9,14,16-17,22-23,32,36H,1-2,10-13,15,18-21,24-31,33-34H2,3-7H3 |
| InChIKey | PAFRKOIUAJWMFE-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.08 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|